About propan-2-yl 4-oxobut-2-enoate
propan-2-yl 4-oxobut-2-enoate (PubChem CID 86106379) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is propan-2-yl 4-oxobut-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl 4-oxobut-2-enoate |
| PubChem CID | 86106379 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | propan-2-yl 4-oxobut-2-enoate |
| SMILES | CC(C)OC(=O)C=CC=O |
| InChI | InChI=1S/C7H10O3/c1-6(2)10-7(9)4-3-5-8/h3-6H,1-2H3 |
| InChIKey | GYSBQAJACPOJTB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-oxobut-2-enoate?
The IUPAC name of propan-2-yl 4-oxobut-2-enoate (CID 86106379) is propan-2-yl 4-oxobut-2-enoate.
What is the SMILES notation for propan-2-yl 4-oxobut-2-enoate?
The canonical SMILES for propan-2-yl 4-oxobut-2-enoate is CC(C)OC(=O)C=CC=O.
What is the InChIKey of propan-2-yl 4-oxobut-2-enoate?
The InChIKey is GYSBQAJACPOJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-6(2)10-7(9)4-3-5-8/h3-6H,1-2H3.
What are the key properties of propan-2-yl 4-oxobut-2-enoate?
propan-2-yl 4-oxobut-2-enoate has a molecular weight of 142.15 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-oxobut-2-enoate is sourced from PubChem (CID 86106379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).