About [(E)-but-2-enyl] (3R)-3-hydroxybutanoate
[(E)-but-2-enyl] (3R)-3-hydroxybutanoate (PubChem CID 139893647) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(E)-but-2-enyl] (3R)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] (3R)-3-hydroxybutanoate |
| PubChem CID | 139893647 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(E)-but-2-enyl] (3R)-3-hydroxybutanoate |
| SMILES | C/C=C/COC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C8H14O3/c1-3-4-5-11-8(10)6-7(2)9/h3-4,7,9H,5-6H2,1-2H3/b4-3+/t7-/m1/s1 |
| InChIKey | PAOSFKRIGGRGMZ-KGGZQZJCSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] (3R)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] (3R)-3-hydroxybutanoate?
The IUPAC name of [(E)-but-2-enyl] (3R)-3-hydroxybutanoate (CID 139893647) is [(E)-but-2-enyl] (3R)-3-hydroxybutanoate.
What is the SMILES notation for [(E)-but-2-enyl] (3R)-3-hydroxybutanoate?
The canonical SMILES for [(E)-but-2-enyl] (3R)-3-hydroxybutanoate is C/C=C/COC(=O)C[C@@H](C)O.
What is the InChIKey of [(E)-but-2-enyl] (3R)-3-hydroxybutanoate?
The InChIKey is PAOSFKRIGGRGMZ-KGGZQZJCSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-4-5-11-8(10)6-7(2)9/h3-4,7,9H,5-6H2,1-2H3/b4-3+/t7-/m1/s1.
What are the key properties of [(E)-but-2-enyl] (3R)-3-hydroxybutanoate?
[(E)-but-2-enyl] (3R)-3-hydroxybutanoate has a molecular weight of 158.20 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] (3R)-3-hydroxybutanoate is sourced from PubChem (CID 139893647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).