C17H29NO4 — CID 88563900
[(E)-but-2-enyl] (Z)-3-[4-(dimethylamino)butanoyloxy]hept-5-enoate (PubChem CID 88563900) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is [(E)-but-2-enyl] (Z)-3-[4-(dimethylamino)butanoyloxy]hept-5-enoate.
| Compound Name | [(E)-but-2-enyl] (Z)-3-[4-(dimethylamino)butanoyloxy]hept-5-enoate |
|---|---|
| PubChem CID | 88563900 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(E)-but-2-enyl] (Z)-3-[4-(dimethylamino)butanoyloxy]hept-5-enoate |
| SMILES | C/C=C\CC(CC(=O)OC/C=C/C)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C17H29NO4/c1-5-7-10-15(14-17(20)21-13-8-6-2)22-16(19)11-9-12-18(3)4/h5-8,15H,9-14H2,1-4H3/b7-5-,8-6+ |
| InChIKey | HCHSBOBWUHHSIJ-CGXWXWIYSA-N |
| XLogP | 2.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|