C17H27NO10 — CID 175901710
4-[3-(3-carboxypropanoyloxy)-2-[4-(dimethylamino)butanoyloxy]propoxy]-4-oxobutanoic acid (PubChem CID 175901710) has the molecular formula C17H27NO10 and a molecular weight of 405.40 g/mol. Its IUPAC name is 4-[3-(3-carboxypropanoyloxy)-2-[4-(dimethylamino)butanoyloxy]propoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-(3-carboxypropanoyloxy)-2-[4-(dimethylamino)butanoyloxy]propoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175901710 |
| Molecular Formula | C17H27NO10 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-[3-(3-carboxypropanoyloxy)-2-[4-(dimethylamino)butanoyloxy]propoxy]-4-oxobutanoic acid |
| SMILES | CN(C)CCCC(=O)OC(COC(=O)CCC(=O)O)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C17H27NO10/c1-18(2)9-3-4-17(25)28-12(10-26-15(23)7-5-13(19)20)11-27-16(24)8-6-14(21)22/h12H,3-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | LLPPNVSIVCZQHV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|