C56H102N2O14 — CID 168884847
[2-[4-[3-(dimethylamino)propoxycarbonyl-[4-[1,3-di(nonanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoyloxy]-3-nonanoyloxypropyl] nonanoate (PubChem CID 168884847) has the molecular formula C56H102N2O14 and a molecular weight of 1027.43 g/mol. Its IUPAC name is [2-[4-[3-(dimethylamino)propoxycarbonyl-[4-[1,3-di(nonanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoyloxy]-3-nonanoyloxypropyl] nonanoate.
| Compound Name | [2-[4-[3-(dimethylamino)propoxycarbonyl-[4-[1,3-di(nonanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoyloxy]-3-nonanoyloxypropyl] nonanoate |
|---|---|
| PubChem CID | 168884847 |
| Molecular Formula | C56H102N2O14 |
| Molecular Weight | 1027.43 g/mol |
| Exact Mass | 1026.73 |
| IUPAC Name | [2-[4-[3-(dimethylamino)propoxycarbonyl-[4-[1,3-di(nonanoyloxy)propan-2-yloxy]-4-oxobutyl]amino]butanoyloxy]-3-nonanoyloxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)OC(=O)CCCN(CCCC(=O)OC(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C56H102N2O14/c1-7-11-15-19-23-27-34-50(59)67-44-48(45-68-51(60)35-28-24-20-16-12-8-2)71-54(63)38-31-41-58(56(65)66-43-33-40-57(5)6)42-32-39-55(64)72-49(46-69-52(61)36-29-25-21-17-13-9-3)47-70-53(62)37-30-26-22-18-14-10-4/h48-49H,7-47H2,1-6H3 |
| InChIKey | NRMPDHMZBOJUDT-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 190.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.43 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|