C29H55NO4 — CID 88563893
[(E)-1-acetyloxy-8,12-dimethylnonadec-2-en-5-yl] 4-(dimethylamino)butanoate (PubChem CID 88563893) has the molecular formula C29H55NO4 and a molecular weight of 481.76 g/mol. Its IUPAC name is [(E)-1-acetyloxy-8,12-dimethylnonadec-2-en-5-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(E)-1-acetyloxy-8,12-dimethylnonadec-2-en-5-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 88563893 |
| Molecular Formula | C29H55NO4 |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 481.41 |
| IUPAC Name | [(E)-1-acetyloxy-8,12-dimethylnonadec-2-en-5-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCCCCCC(C)CCCC(C)CCC(C/C=C/COC(C)=O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C29H55NO4/c1-7-8-9-10-11-16-25(2)17-14-18-26(3)21-22-28(19-12-13-24-33-27(4)31)34-29(32)20-15-23-30(5)6/h12-13,25-26,28H,7-11,14-24H2,1-6H3/b13-12+ |
| InChIKey | GCUMMMLSRJUORC-OUKQBFOZSA-N |
| XLogP | 7.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|