C19H31NO6 — CID 88563891
[(2Z,7Z)-1,9-diacetyloxynona-2,7-dien-5-yl] 4-(dimethylamino)butanoate (PubChem CID 88563891) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is [(2Z,7Z)-1,9-diacetyloxynona-2,7-dien-5-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(2Z,7Z)-1,9-diacetyloxynona-2,7-dien-5-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 88563891 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [(2Z,7Z)-1,9-diacetyloxynona-2,7-dien-5-yl] 4-(dimethylamino)butanoate |
| SMILES | CC(=O)OC/C=C\CC(C/C=C\COC(C)=O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C19H31NO6/c1-16(21)24-14-7-5-10-18(11-6-8-15-25-17(2)22)26-19(23)12-9-13-20(3)4/h5-8,18H,9-15H2,1-4H3/b7-5-,8-6- |
| InChIKey | WVRWVHMBRPVSEC-SFECMWDFSA-N |
| XLogP | 2.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|