C6H8Br2O2 — CID 19833073
[(E)-but-2-enyl] 2,2-dibromoacetate (PubChem CID 19833073) has the molecular formula C6H8Br2O2 and a molecular weight of 271.94 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2,2-dibromoacetate.
| Compound Name | [(E)-but-2-enyl] 2,2-dibromoacetate |
|---|---|
| PubChem CID | 19833073 |
| Molecular Formula | C6H8Br2O2 |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | [(E)-but-2-enyl] 2,2-dibromoacetate |
| SMILES | C/C=C/COC(=O)C(Br)Br |
| InChI | InChI=1S/C6H8Br2O2/c1-2-3-4-10-6(9)5(7)8/h2-3,5H,4H2,1H3/b3-2+ |
| InChIKey | HJGZPZKQYDSDBW-NSCUHMNNSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|