C16H26O7 — CID 132969610
(E,4S,7R)-7-[(E,4S,7R)-4,7-dihydroxyoct-2-enoyl]oxy-4-hydroxyoct-2-enoic acid (PubChem CID 132969610) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is (E,4S,7R)-7-[(E,4S,7R)-4,7-dihydroxyoct-2-enoyl]oxy-4-hydroxyoct-2-enoic acid.
| Compound Name | (E,4S,7R)-7-[(E,4S,7R)-4,7-dihydroxyoct-2-enoyl]oxy-4-hydroxyoct-2-enoic acid |
|---|---|
| PubChem CID | 132969610 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (E,4S,7R)-7-[(E,4S,7R)-4,7-dihydroxyoct-2-enoyl]oxy-4-hydroxyoct-2-enoic acid |
| SMILES | C[C@H](CC[C@H](O)/C=C/C(=O)O)OC(=O)/C=C/[C@@H](O)CC[C@@H](C)O |
| InChI | InChI=1S/C16H26O7/c1-11(17)3-5-13(18)8-10-16(22)23-12(2)4-6-14(19)7-9-15(20)21/h7-14,17-19H,3-6H2,1-2H3,(H,20,21)/b9-7+,10-8+/t11-,12-,13+,14+/m1/s1 |
| InChIKey | ORRRSPCMMIBQHB-UTBFYLPBSA-N |
| XLogP | 0.78 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|