C14H18FeO7 — CID 10959149
carbon monoxide;iron;methyl (2E,4E,6S,9R)-6,9-dihydroxydeca-2,4-dienoate (PubChem CID 10959149) has the molecular formula C14H18FeO7 and a molecular weight of 354.14 g/mol. Its IUPAC name is carbon monoxide;iron;methyl (2E,4E,6S,9R)-6,9-dihydroxydeca-2,4-dienoate.
| Compound Name | carbon monoxide;iron;methyl (2E,4E,6S,9R)-6,9-dihydroxydeca-2,4-dienoate |
|---|---|
| PubChem CID | 10959149 |
| Molecular Formula | C14H18FeO7 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | carbon monoxide;iron;methyl (2E,4E,6S,9R)-6,9-dihydroxydeca-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/[C@@H](O)CC[C@@H](C)O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C11H18O4.3CO.Fe/c1-9(12)7-8-10(13)5-3-4-6-11(14)15-2;3*1-2;/h3-6,9-10,12-13H,7-8H2,1-2H3;;;;/b5-3+,6-4+;;;;/t9-,10-;;;;/m1..../s1 |
| InChIKey | BWSAUNDDZBCLNX-BMUYBINZSA-N |
| XLogP | 0.68 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|