(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid

C10H16O4 — CID 139589661

IUPAC(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid
SMILESC[C@@H](O)CC[C@@H](O)/C=C/C=C\C(=O)O
InChIInChI=1S/C10H16O4/c1-8(11)6-7-9(12)4-2-3-5-10(13)14/h2-5,8-9,11-12H,6-7H2,1H3,(H,13,14)/b4-2+,5-3-/t8-,9+/m1/s1
InChIKeyQMMVXQIBLWLVGD-DKWSLFAKSA-N
MW200.23 g/mol
LogP0.71
Rot. Bonds6

About (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid

(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid (PubChem CID 139589661) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid.

Molecular Properties

Compound Name(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid
PubChem CID139589661
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid
SMILESC[C@@H](O)CC[C@@H](O)/C=C/C=C\C(=O)O
InChIInChI=1S/C10H16O4/c1-8(11)6-7-9(12)4-2-3-5-10(13)14/h2-5,8-9,11-12H,6-7H2,1H3,(H,13,14)/b4-2+,5-3-/t8-,9+/m1/s1
InChIKeyQMMVXQIBLWLVGD-DKWSLFAKSA-N
XLogP0.71
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 50.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid?
The IUPAC name of (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid (CID 139589661) is (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid.
What is the SMILES notation for (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid?
The canonical SMILES for (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid is C[C@@H](O)CC[C@@H](O)/C=C/C=C\C(=O)O.
What is the InChIKey of (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid?
The InChIKey is QMMVXQIBLWLVGD-DKWSLFAKSA-N. The full InChI is InChI=1S/C10H16O4/c1-8(11)6-7-9(12)4-2-3-5-10(13)14/h2-5,8-9,11-12H,6-7H2,1H3,(H,13,14)/b4-2+,5-3-/t8-,9+/m1/s1.
What are the key properties of (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid?
(2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid has a molecular weight of 200.23 g/mol, XLogP of 0.71, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E,6R,9R)-6,9-dihydroxydeca-2,4-dienoic acid is sourced from PubChem (CID 139589661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).