C24H36O6 — CID 172701312
(8E)-7,13,15,23-tetrahydroxytetracosa-2,4,8,10,16,18-hexaenoic acid (PubChem CID 172701312) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is (8E)-7,13,15,23-tetrahydroxytetracosa-2,4,8,10,16,18-hexaenoic acid.
| Compound Name | (8E)-7,13,15,23-tetrahydroxytetracosa-2,4,8,10,16,18-hexaenoic acid |
|---|---|
| PubChem CID | 172701312 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (8E)-7,13,15,23-tetrahydroxytetracosa-2,4,8,10,16,18-hexaenoic acid |
| SMILES | CC(O)CCCC=CC=CC(O)CC(O)CC=C/C=C/C(O)CC=CC=CC(=O)O |
| InChI | InChI=1S/C24H36O6/c1-20(25)13-7-3-2-4-8-16-22(27)19-23(28)17-11-5-9-14-21(26)15-10-6-12-18-24(29)30/h2,4-6,8-12,14,16,18,20-23,25-28H,3,7,13,15,17,19H2,1H3,(H,29,30)/b4-2?,10-6?,11-5?,14-9+,16-8?,18-12? |
| InChIKey | CZSPLEVIVZNWLV-CAOGAUQTSA-N |
| XLogP | 3.21 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|