C9H16O3 — CID 10866796
(E,5R,8R)-5,8-dihydroxynon-3-en-2-one (PubChem CID 10866796) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (E,5R,8R)-5,8-dihydroxynon-3-en-2-one.
| Compound Name | (E,5R,8R)-5,8-dihydroxynon-3-en-2-one |
|---|---|
| PubChem CID | 10866796 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (E,5R,8R)-5,8-dihydroxynon-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@H](O)CC[C@@H](C)O |
| InChI | InChI=1S/C9H16O3/c1-7(10)3-5-9(12)6-4-8(2)11/h3,5,8-9,11-12H,4,6H2,1-2H3/b5-3+/t8-,9+/m1/s1 |
| InChIKey | AGDPKGYELUBUND-ZHBVTVBMSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|