About (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one
(E)-5-hydroxy-7,8-dimethylnon-3-en-2-one (PubChem CID 87291906) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one |
| PubChem CID | 87291906 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one |
| SMILES | CC(=O)/C=C/C(O)CC(C)C(C)C |
| InChI | InChI=1S/C11H20O2/c1-8(2)9(3)7-11(13)6-5-10(4)12/h5-6,8-9,11,13H,7H2,1-4H3/b6-5+ |
| InChIKey | ZBNQRAHDEYICOC-AATRIKPKSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one?
The IUPAC name of (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one (CID 87291906) is (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one.
What is the SMILES notation for (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one?
The canonical SMILES for (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one is CC(=O)/C=C/C(O)CC(C)C(C)C.
What is the InChIKey of (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one?
The InChIKey is ZBNQRAHDEYICOC-AATRIKPKSA-N. The full InChI is InChI=1S/C11H20O2/c1-8(2)9(3)7-11(13)6-5-10(4)12/h5-6,8-9,11,13H,7H2,1-4H3/b6-5+.
What are the key properties of (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one?
(E)-5-hydroxy-7,8-dimethylnon-3-en-2-one has a molecular weight of 184.28 g/mol, XLogP of 2.17, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-hydroxy-7,8-dimethylnon-3-en-2-one is sourced from PubChem (CID 87291906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).