C8H18O — CID 124507307
(2R,4S)-4,5-dimethylhexan-2-ol (PubChem CID 124507307) has the molecular formula C8H18O and a molecular weight of 130.23 g/mol. Its IUPAC name is (2R,4S)-4,5-dimethylhexan-2-ol.
| Compound Name | (2R,4S)-4,5-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 124507307 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | (2R,4S)-4,5-dimethylhexan-2-ol |
| SMILES | CC(C)[C@@H](C)C[C@@H](C)O |
| InChI | InChI=1S/C8H18O/c1-6(2)7(3)5-8(4)9/h6-9H,5H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | KHSOOQUMPPYGAW-JGVFFNPUSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |