C9H20O2 — CID 118216502
(2S,5R)-3-propan-2-ylhexane-2,5-diol (PubChem CID 118216502) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is (2S,5R)-3-propan-2-ylhexane-2,5-diol.
| Compound Name | (2S,5R)-3-propan-2-ylhexane-2,5-diol |
|---|---|
| PubChem CID | 118216502 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | (2S,5R)-3-propan-2-ylhexane-2,5-diol |
| SMILES | CC(C)C(C[C@@H](C)O)[C@H](C)O |
| InChI | InChI=1S/C9H20O2/c1-6(2)9(8(4)11)5-7(3)10/h6-11H,5H2,1-4H3/t7-,8+,9?/m1/s1 |
| InChIKey | ASGOEYDWMLHDHG-WGTSGOJVSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |