C6H10O2 — CID 59975420
(Z,5R)-5-hydroxyhex-3-en-2-one (PubChem CID 59975420) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (Z,5R)-5-hydroxyhex-3-en-2-one.
| Compound Name | (Z,5R)-5-hydroxyhex-3-en-2-one |
|---|---|
| PubChem CID | 59975420 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (Z,5R)-5-hydroxyhex-3-en-2-one |
| SMILES | CC(=O)/C=C\[C@@H](C)O |
| InChI | InChI=1S/C6H10O2/c1-5(7)3-4-6(2)8/h3-5,7H,1-2H3/b4-3-/t5-/m1/s1 |
| InChIKey | BHLOMPMLNMZBRZ-CLBPYYFESA-N |
| XLogP | 0.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|