About (E)-5,5-difluoropent-3-en-2-one;ethane
(E)-5,5-difluoropent-3-en-2-one;ethane (PubChem CID 177000471) has the molecular formula C7H12F2O
and a molecular weight of 150.17 g/mol. Its IUPAC name is (E)-5,5-difluoropent-3-en-2-one;ethane.
Molecular Properties
| Compound Name | (E)-5,5-difluoropent-3-en-2-one;ethane |
| PubChem CID | 177000471 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (E)-5,5-difluoropent-3-en-2-one;ethane |
| SMILES | CC.CC(=O)/C=C/C(F)F |
| InChI | InChI=1S/C5H6F2O.C2H6/c1-4(8)2-3-5(6)7;1-2/h2-3,5H,1H3;1-2H3/b3-2+; |
| InChIKey | ATHVVEQAYLOZKC-SQQVDAMQSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-difluoropent-3-en-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-difluoropent-3-en-2-one;ethane?
The IUPAC name of (E)-5,5-difluoropent-3-en-2-one;ethane (CID 177000471) is (E)-5,5-difluoropent-3-en-2-one;ethane.
What is the SMILES notation for (E)-5,5-difluoropent-3-en-2-one;ethane?
The canonical SMILES for (E)-5,5-difluoropent-3-en-2-one;ethane is CC.CC(=O)/C=C/C(F)F.
What is the InChIKey of (E)-5,5-difluoropent-3-en-2-one;ethane?
The InChIKey is ATHVVEQAYLOZKC-SQQVDAMQSA-N. The full InChI is InChI=1S/C5H6F2O.C2H6/c1-4(8)2-3-5(6)7;1-2/h2-3,5H,1H3;1-2H3/b3-2+;.
What are the key properties of (E)-5,5-difluoropent-3-en-2-one;ethane?
(E)-5,5-difluoropent-3-en-2-one;ethane has a molecular weight of 150.17 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-difluoropent-3-en-2-one;ethane is sourced from PubChem (CID 177000471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).