C9H12F3NO2 — CID 142240713
N-methyl-N-(1,1,1-trifluoro-5-oxohex-3-en-2-yl)acetamide (PubChem CID 142240713) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is N-methyl-N-(1,1,1-trifluoro-5-oxohex-3-en-2-yl)acetamide.
| Compound Name | N-methyl-N-(1,1,1-trifluoro-5-oxohex-3-en-2-yl)acetamide |
|---|---|
| PubChem CID | 142240713 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-methyl-N-(1,1,1-trifluoro-5-oxohex-3-en-2-yl)acetamide |
| SMILES | CC(=O)C=CC(N(C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2/c1-6(14)4-5-8(9(10,11)12)13(3)7(2)15/h4-5,8H,1-3H3 |
| InChIKey | FJTYKPNYORDEGC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|