C9H15BrMgO3 — CID 134847439
magnesium;(Z,5R,8R)-8-hydroxy-2-oxonon-3-en-5-olate;bromide (PubChem CID 134847439) has the molecular formula C9H15BrMgO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is magnesium;(Z,5R,8R)-8-hydroxy-2-oxonon-3-en-5-olate;bromide.
| Compound Name | magnesium;(Z,5R,8R)-8-hydroxy-2-oxonon-3-en-5-olate;bromide |
|---|---|
| PubChem CID | 134847439 |
| Molecular Formula | C9H15BrMgO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | magnesium;(Z,5R,8R)-8-hydroxy-2-oxonon-3-en-5-olate;bromide |
| SMILES | CC(=O)/C=C\[C@H]([O-])CC[C@@H](C)O.[Br-].[Mg+2] |
| InChI | InChI=1S/C9H15O3.BrH.Mg/c1-7(10)3-5-9(12)6-4-8(2)11;;/h3,5,8-9,11H,4,6H2,1-2H3;1H;/q-1;;+2/p-1/b5-3-;;/t8-,9+;;/m1../s1 |
| InChIKey | WLHNKIHIVNSDSX-ACXXXGJWSA-M |
| XLogP | -3.36 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|