2,5-dihydroxyhexanoic acid

C6H12O4 — CID 18424665

IUPAC2,5-dihydroxyhexanoic acid
SMILESCC(O)CCC(O)C(=O)O
InChIInChI=1S/C6H12O4/c1-4(7)2-3-5(8)6(9)10/h4-5,7-8H,2-3H2,1H3,(H,9,10)
InChIKeyQDKYRZRRXQKVJI-UHFFFAOYSA-N
MW148.16 g/mol
LogP-0.41
Rot. Bonds4

About 2,5-dihydroxyhexanoic acid

2,5-dihydroxyhexanoic acid (PubChem CID 18424665) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,5-dihydroxyhexanoic acid.

Molecular Properties

Compound Name2,5-dihydroxyhexanoic acid
PubChem CID18424665
Molecular FormulaC6H12O4
Molecular Weight148.16 g/mol
Exact Mass148.07
IUPAC Name2,5-dihydroxyhexanoic acid
SMILESCC(O)CCC(O)C(=O)O
InChIInChI=1S/C6H12O4/c1-4(7)2-3-5(8)6(9)10/h4-5,7-8H,2-3H2,1H3,(H,9,10)
InChIKeyQDKYRZRRXQKVJI-UHFFFAOYSA-N
XLogP-0.41
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.16
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,5-dihydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dihydroxyhexanoic acid?
The IUPAC name of 2,5-dihydroxyhexanoic acid (CID 18424665) is 2,5-dihydroxyhexanoic acid.
What is the SMILES notation for 2,5-dihydroxyhexanoic acid?
The canonical SMILES for 2,5-dihydroxyhexanoic acid is CC(O)CCC(O)C(=O)O.
What is the InChIKey of 2,5-dihydroxyhexanoic acid?
The InChIKey is QDKYRZRRXQKVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4/c1-4(7)2-3-5(8)6(9)10/h4-5,7-8H,2-3H2,1H3,(H,9,10).
What are the key properties of 2,5-dihydroxyhexanoic acid?
2,5-dihydroxyhexanoic acid has a molecular weight of 148.16 g/mol, XLogP of -0.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydroxyhexanoic acid is sourced from PubChem (CID 18424665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).