About ethane;hexane-2,5-diol
ethane;hexane-2,5-diol (PubChem CID 143963822) has the molecular formula C8H20O2
and a molecular weight of 148.25 g/mol. Its IUPAC name is ethane;hexane-2,5-diol.
Molecular Properties
| Compound Name | ethane;hexane-2,5-diol |
| PubChem CID | 143963822 |
| Molecular Formula | C8H20O2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.15 |
| IUPAC Name | ethane;hexane-2,5-diol |
| SMILES | CC.CC(O)CCC(C)O |
| InChI | InChI=1S/C6H14O2.C2H6/c1-5(7)3-4-6(2)8;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | ITEKQVBPSLDKIJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;hexane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexane-2,5-diol?
The IUPAC name of ethane;hexane-2,5-diol (CID 143963822) is ethane;hexane-2,5-diol.
What is the SMILES notation for ethane;hexane-2,5-diol?
The canonical SMILES for ethane;hexane-2,5-diol is CC.CC(O)CCC(C)O.
What is the InChIKey of ethane;hexane-2,5-diol?
The InChIKey is ITEKQVBPSLDKIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C2H6/c1-5(7)3-4-6(2)8;1-2/h5-8H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;hexane-2,5-diol?
ethane;hexane-2,5-diol has a molecular weight of 148.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexane-2,5-diol is sourced from PubChem (CID 143963822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).