C15H32O5 — CID 175190041
pentadecane-2,5,8,11,14-pentol (PubChem CID 175190041) has the molecular formula C15H32O5 and a molecular weight of 292.42 g/mol. Its IUPAC name is pentadecane-2,5,8,11,14-pentol.
| Compound Name | pentadecane-2,5,8,11,14-pentol |
|---|---|
| PubChem CID | 175190041 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | pentadecane-2,5,8,11,14-pentol |
| SMILES | CC(O)CCC(O)CCC(O)CCC(O)CCC(C)O |
| InChI | InChI=1S/C15H32O5/c1-11(16)3-5-13(18)7-9-15(20)10-8-14(19)6-4-12(2)17/h11-20H,3-10H2,1-2H3 |
| InChIKey | MIDCEMNAPGCDAC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |