About ethane;5-methylhexan-2-ol
ethane;5-methylhexan-2-ol (PubChem CID 144624886) has the molecular formula C11H28O
and a molecular weight of 176.34 g/mol. Its IUPAC name is ethane;5-methylhexan-2-ol.
Molecular Properties
| Compound Name | ethane;5-methylhexan-2-ol |
| PubChem CID | 144624886 |
| Molecular Formula | C11H28O |
| Molecular Weight | 176.34 g/mol |
| Exact Mass | 176.21 |
| IUPAC Name | ethane;5-methylhexan-2-ol |
| SMILES | CC.CC.CC(C)CCC(C)O |
| InChI | InChI=1S/C7H16O.2C2H6/c1-6(2)4-5-7(3)8;2*1-2/h6-8H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | JMCMXFBGTMFCHZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-methylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylhexan-2-ol?
The IUPAC name of ethane;5-methylhexan-2-ol (CID 144624886) is ethane;5-methylhexan-2-ol.
What is the SMILES notation for ethane;5-methylhexan-2-ol?
The canonical SMILES for ethane;5-methylhexan-2-ol is CC.CC.CC(C)CCC(C)O.
What is the InChIKey of ethane;5-methylhexan-2-ol?
The InChIKey is JMCMXFBGTMFCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.2C2H6/c1-6(2)4-5-7(3)8;2*1-2/h6-8H,4-5H2,1-3H3;2*1-2H3.
What are the key properties of ethane;5-methylhexan-2-ol?
ethane;5-methylhexan-2-ol has a molecular weight of 176.34 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylhexan-2-ol is sourced from PubChem (CID 144624886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).