About (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane
(E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane (PubChem CID 143593952) has the molecular formula C8H20NO3+
and a molecular weight of 178.25 g/mol. Its IUPAC name is (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane.
Molecular Properties
| Compound Name | (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane |
| PubChem CID | 143593952 |
| Molecular Formula | C8H20NO3+ |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane |
| SMILES | CC.CC(O)CCC(O)/C=[NH+]/O |
| InChI | InChI=1S/C6H13NO3.C2H6/c1-5(8)2-3-6(9)4-7-10;1-2/h4-6,8-10H,2-3H2,1H3;1-2H3/p+1/b7-4+; |
| InChIKey | HALIKECBFHAELS-KQGICBIGSA-O |
| XLogP | -0.92 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane?
The IUPAC name of (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane (CID 143593952) is (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane.
What is the SMILES notation for (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane?
The canonical SMILES for (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane is CC.CC(O)CCC(O)/C=[NH+]/O.
What is the InChIKey of (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane?
The InChIKey is HALIKECBFHAELS-KQGICBIGSA-O. The full InChI is InChI=1S/C6H13NO3.C2H6/c1-5(8)2-3-6(9)4-7-10;1-2/h4-6,8-10H,2-3H2,1H3;1-2H3/p+1/b7-4+;.
What are the key properties of (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane?
(E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane has a molecular weight of 178.25 g/mol, XLogP of -0.92, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-dihydroxyhexylidene(hydroxy)azanium;ethane is sourced from PubChem (CID 143593952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).