C11H20O5 — CID 42643087
methyl (E,4S,7S)-7-hydroxy-4-(methoxymethoxy)oct-2-enoate (PubChem CID 42643087) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (E,4S,7S)-7-hydroxy-4-(methoxymethoxy)oct-2-enoate.
| Compound Name | methyl (E,4S,7S)-7-hydroxy-4-(methoxymethoxy)oct-2-enoate |
|---|---|
| PubChem CID | 42643087 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | methyl (E,4S,7S)-7-hydroxy-4-(methoxymethoxy)oct-2-enoate |
| SMILES | COCO[C@H](/C=C/C(=O)OC)CC[C@H](C)O |
| InChI | InChI=1S/C11H20O5/c1-9(12)4-5-10(16-8-14-2)6-7-11(13)15-3/h6-7,9-10,12H,4-5,8H2,1-3H3/b7-6+/t9-,10-/m0/s1 |
| InChIKey | NMOAVRRYGPTCJC-CAFLDADYSA-N |
| XLogP | 0.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|