C16H24O6 — CID 57342766
[(2R,3S)-3-hydroxypent-4-en-2-yl] (E,4R,7R)-4-hydroxy-7-prop-2-enoyloxyoct-2-enoate (PubChem CID 57342766) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is [(2R,3S)-3-hydroxypent-4-en-2-yl] (E,4R,7R)-4-hydroxy-7-prop-2-enoyloxyoct-2-enoate.
| Compound Name | [(2R,3S)-3-hydroxypent-4-en-2-yl] (E,4R,7R)-4-hydroxy-7-prop-2-enoyloxyoct-2-enoate |
|---|---|
| PubChem CID | 57342766 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(2R,3S)-3-hydroxypent-4-en-2-yl] (E,4R,7R)-4-hydroxy-7-prop-2-enoyloxyoct-2-enoate |
| SMILES | C=CC(=O)O[C@H](C)CC[C@@H](O)/C=C/C(=O)O[C@H](C)[C@@H](O)C=C |
| InChI | InChI=1S/C16H24O6/c1-5-14(18)12(4)22-16(20)10-9-13(17)8-7-11(3)21-15(19)6-2/h5-6,9-14,17-18H,1-2,7-8H2,3-4H3/b10-9+/t11-,12-,13-,14+/m1/s1 |
| InChIKey | XESZSTBNZZJRTB-DCOHZSIJSA-N |
| XLogP | 1.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|