C18H28O8 — CID 24770706
[(2S,3R)-3-hydroxypent-4-en-2-yl] (4R,5S)-4-hydroxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate (PubChem CID 24770706) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxypent-4-en-2-yl] (4R,5S)-4-hydroxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate.
| Compound Name | [(2S,3R)-3-hydroxypent-4-en-2-yl] (4R,5S)-4-hydroxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 24770706 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(2S,3R)-3-hydroxypent-4-en-2-yl] (4R,5S)-4-hydroxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
| SMILES | C=CC(=O)O[C@H](C)CC(=O)O[C@@H](C)[C@H](O)CCC(=O)O[C@@H](C)[C@H](O)C=C |
| InChI | InChI=1S/C18H28O8/c1-6-14(19)12(4)25-17(22)9-8-15(20)13(5)26-18(23)10-11(3)24-16(21)7-2/h6-7,11-15,19-20H,1-2,8-10H2,3-5H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | MCEXMCGFROMIOQ-GZBLMMOJSA-N |
| XLogP | 1.05 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|