C11H18O4 — CID 150811634
(E)-4-(4-methylhexan-2-yloxy)-4-oxobut-2-enoic acid (PubChem CID 150811634) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (E)-4-(4-methylhexan-2-yloxy)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(4-methylhexan-2-yloxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 150811634 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (E)-4-(4-methylhexan-2-yloxy)-4-oxobut-2-enoic acid |
| SMILES | CCC(C)CC(C)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H18O4/c1-4-8(2)7-9(3)15-11(14)6-5-10(12)13/h5-6,8-9H,4,7H2,1-3H3,(H,12,13)/b6-5+ |
| InChIKey | KIAFKJLDGGTUKH-AATRIKPKSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|