C16H18O4 — CID 10978671
6-(2-ethenoxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 10978671) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-(2-ethenoxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-(2-ethenoxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10978671 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-(2-ethenoxy-2-phenylethyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=COC(CC1=CC(=O)OC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C16H18O4/c1-4-18-14(12-8-6-5-7-9-12)10-13-11-15(17)20-16(2,3)19-13/h4-9,11,14H,1,10H2,2-3H3 |
| InChIKey | HXOZWBVNXDIEMS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|