C16H20O3 — CID 11780245
2,2-dimethyl-6-[(2R)-1-phenylbutan-2-yl]-1,3-dioxin-4-one (PubChem CID 11780245) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(2R)-1-phenylbutan-2-yl]-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-[(2R)-1-phenylbutan-2-yl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11780245 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,2-dimethyl-6-[(2R)-1-phenylbutan-2-yl]-1,3-dioxin-4-one |
| SMILES | CC[C@H](Cc1ccccc1)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H20O3/c1-4-13(10-12-8-6-5-7-9-12)14-11-15(17)19-16(2,3)18-14/h5-9,11,13H,4,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | OETVSACOVDFDTO-CYBMUJFWSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |