C9H14O5 — CID 10608161
6-(1-hydroperoxypropyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 10608161) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 6-(1-hydroperoxypropyl)-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-(1-hydroperoxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10608161 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 6-(1-hydroperoxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CCC(OO)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C9H14O5/c1-4-6(14-11)7-5-8(10)13-9(2,3)12-7/h5-6,11H,4H2,1-3H3 |
| InChIKey | QANCPPCWERHRHY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|