C16H18O4 — CID 11300299
2,2-dimethyl-6-(1-oxo-1-phenylbutan-2-yl)-1,3-dioxin-4-one (PubChem CID 11300299) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1-oxo-1-phenylbutan-2-yl)-1,3-dioxin-4-one.
| Compound Name | 2,2-dimethyl-6-(1-oxo-1-phenylbutan-2-yl)-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11300299 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2,2-dimethyl-6-(1-oxo-1-phenylbutan-2-yl)-1,3-dioxin-4-one |
| SMILES | CCC(C(=O)c1ccccc1)C1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H18O4/c1-4-12(15(18)11-8-6-5-7-9-11)13-10-14(17)20-16(2,3)19-13/h5-10,12H,4H2,1-3H3 |
| InChIKey | RUOMVWIJPUYDFH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |