C21H23NO — CID 22290602
2-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylbutan-1-one (PubChem CID 22290602) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylbutan-1-one.
| Compound Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 22290602 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylbutan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)C1=NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C21H23NO/c1-4-17(20(23)15-10-6-5-7-11-15)19-18-13-9-8-12-16(18)14-21(2,3)22-19/h5-13,17H,4,14H2,1-3H3 |
| InChIKey | BBAIBFFLJLEPHR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |