C20H21NO — CID 7000503
(1R)-1-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylpropan-2-one (PubChem CID 7000503) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (1R)-1-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylpropan-2-one.
| Compound Name | (1R)-1-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 7000503 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (1R)-1-(3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylpropan-2-one |
| SMILES | CC(=O)[C@@H](C1=NC(C)(C)Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-14(22)18(15-9-5-4-6-10-15)19-17-12-8-7-11-16(17)13-20(2,3)21-19/h4-12,18H,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | MUUYHGGASQIQSM-GOSISDBHSA-N |
| XLogP | 4.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |