C20H22N4O — CID 91546533
2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-[(4-methylphenyl)diazenyl]acetamide (PubChem CID 91546533) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-[(4-methylphenyl)diazenyl]acetamide.
| Compound Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-[(4-methylphenyl)diazenyl]acetamide |
|---|---|
| PubChem CID | 91546533 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-[(4-methylphenyl)diazenyl]acetamide |
| SMILES | Cc1ccc(/N=N/C(C(N)=O)C2=NC(C)(C)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-13-8-10-15(11-9-13)23-24-18(19(21)25)17-16-7-5-4-6-14(16)12-20(2,3)22-17/h4-11,18H,12H2,1-3H3,(H2,21,25)/b24-23+ |
| InChIKey | JNYPYTYBIXMVLT-WCWDXBQESA-N |
| XLogP | 3.76 |
| TPSA | 80.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|