C12H16ClN — CID 52995067
1,3,3-trimethyl-4H-isoquinoline;hydrochloride (PubChem CID 52995067) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 1,3,3-trimethyl-4H-isoquinoline;hydrochloride.
| Compound Name | 1,3,3-trimethyl-4H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 52995067 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,3,3-trimethyl-4H-isoquinoline;hydrochloride |
| SMILES | CC1=NC(C)(C)Cc2ccccc21.Cl |
| InChI | InChI=1S/C12H15N.ClH/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;/h4-7H,8H2,1-3H3;1H |
| InChIKey | JAOGQYKPUONGAZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |