C12H14N2O — CID 135601158
(NE)-N-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylidene]hydroxylamine (PubChem CID 135601158) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (NE)-N-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135601158 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (NE)-N-[(3,3-dimethyl-4H-isoquinolin-1-yl)methylidene]hydroxylamine |
| SMILES | CC1(C)Cc2ccccc2C(/C=N/O)=N1 |
| InChI | InChI=1S/C12H14N2O/c1-12(2)7-9-5-3-4-6-10(9)11(14-12)8-13-15/h3-6,8,15H,7H2,1-2H3/b13-8+ |
| InChIKey | IFLDNXUVZGBOPH-MDWZMJQESA-N |
| XLogP | 2.27 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|