C16H21NO2 — CID 7453181
ethyl (2R)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)propanoate (PubChem CID 7453181) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl (2R)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)propanoate.
| Compound Name | ethyl (2R)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)propanoate |
|---|---|
| PubChem CID | 7453181 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl (2R)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)propanoate |
| SMILES | CCOC(=O)[C@H](C)C1=NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C16H21NO2/c1-5-19-15(18)11(2)14-13-9-7-6-8-12(13)10-16(3,4)17-14/h6-9,11H,5,10H2,1-4H3/t11-/m1/s1 |
| InChIKey | XCVWSOMTPIRYPM-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |