About 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline
3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline (PubChem CID 90308725) has the molecular formula C22H22N2
and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline.
Molecular Properties
| Compound Name | 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline |
| PubChem CID | 90308725 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline |
| SMILES | Cc1cc2cc(C3=NC(C)(C)Cc4ccccc43)cnc2cc1C |
| InChI | InChI=1S/C22H22N2/c1-14-9-17-11-18(13-23-20(17)10-15(14)2)21-19-8-6-5-7-16(19)12-22(3,4)24-21/h5-11,13H,12H2,1-4H3 |
| InChIKey | LTMXIBPUTPZVFF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline?
The IUPAC name of 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline (CID 90308725) is 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline.
What is the SMILES notation for 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline?
The canonical SMILES for 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline is Cc1cc2cc(C3=NC(C)(C)Cc4ccccc43)cnc2cc1C.
What is the InChIKey of 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline?
The InChIKey is LTMXIBPUTPZVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2/c1-14-9-17-11-18(13-23-20(17)10-15(14)2)21-19-8-6-5-7-16(19)12-22(3,4)24-21/h5-11,13H,12H2,1-4H3.
What are the key properties of 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline?
3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline has a molecular weight of 314.43 g/mol, XLogP of 5.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethyl-4H-isoquinolin-1-yl)-6,7-dimethylquinoline is sourced from PubChem (CID 90308725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).