C12H16OS2 — CID 12815307
2,2-bis(ethylsulfanyl)-1-phenylethanone (PubChem CID 12815307) has the molecular formula C12H16OS2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,2-bis(ethylsulfanyl)-1-phenylethanone.
| Compound Name | 2,2-bis(ethylsulfanyl)-1-phenylethanone |
|---|---|
| PubChem CID | 12815307 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2,2-bis(ethylsulfanyl)-1-phenylethanone |
| SMILES | CCSC(SCC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16OS2/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | BNKJLQUQVJSRDS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|