C18H20OS — CID 4125598
2-butylsulfanyl-1,2-diphenylethanone (PubChem CID 4125598) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-butylsulfanyl-1,2-diphenylethanone.
| Compound Name | 2-butylsulfanyl-1,2-diphenylethanone |
|---|---|
| PubChem CID | 4125598 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-butylsulfanyl-1,2-diphenylethanone |
| SMILES | CCCCSC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20OS/c1-2-3-14-20-18(16-12-8-5-9-13-16)17(19)15-10-6-4-7-11-15/h4-13,18H,2-3,14H2,1H3 |
| InChIKey | OLVIHVXXOWRBIQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|