C21H25NO3 — CID 175760029
(2S)-2-[methyl-(2-oxo-1,2-diphenylethyl)amino]hexanoic acid (PubChem CID 175760029) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S)-2-[methyl-(2-oxo-1,2-diphenylethyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[methyl-(2-oxo-1,2-diphenylethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175760029 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S)-2-[methyl-(2-oxo-1,2-diphenylethyl)amino]hexanoic acid |
| SMILES | CCCC[C@@H](C(=O)O)N(C)C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-3-4-15-18(21(24)25)22(2)19(16-11-7-5-8-12-16)20(23)17-13-9-6-10-14-17/h5-14,18-19H,3-4,15H2,1-2H3,(H,24,25)/t18-,19?/m0/s1 |
| InChIKey | JRSUBPOXMJIOMX-OYKVQYDMSA-N |
| XLogP | 4.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |