C17H29Cl2NO3 — CID 142749473
2-[2-[(2-hydroxy-2-phenylethyl)-methylamino]ethyl]hexanoic acid;dihydrochloride (PubChem CID 142749473) has the molecular formula C17H29Cl2NO3 and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-2-phenylethyl)-methylamino]ethyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-[2-[(2-hydroxy-2-phenylethyl)-methylamino]ethyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 142749473 |
| Molecular Formula | C17H29Cl2NO3 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[2-[(2-hydroxy-2-phenylethyl)-methylamino]ethyl]hexanoic acid;dihydrochloride |
| SMILES | CCCCC(CCN(C)CC(O)c1ccccc1)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C17H27NO3.2ClH/c1-3-4-8-15(17(20)21)11-12-18(2)13-16(19)14-9-6-5-7-10-14;;/h5-7,9-10,15-16,19H,3-4,8,11-13H2,1-2H3,(H,20,21);2*1H |
| InChIKey | JYJHNQMGYCOKTQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |