C12H16O3S — CID 63857542
2-(3-methoxypropylsulfanyl)-2-phenylacetic acid (PubChem CID 63857542) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(3-methoxypropylsulfanyl)-2-phenylacetic acid.
| Compound Name | 2-(3-methoxypropylsulfanyl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 63857542 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(3-methoxypropylsulfanyl)-2-phenylacetic acid |
| SMILES | COCCCSC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3S/c1-15-8-5-9-16-11(12(13)14)10-6-3-2-4-7-10/h2-4,6-7,11H,5,8-9H2,1H3,(H,13,14) |
| InChIKey | VPZFIYLMHZBLGW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|