C18H20O2 — CID 115601489
5-methoxy-1,1-diphenylpentan-2-one (PubChem CID 115601489) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-methoxy-1,1-diphenylpentan-2-one.
| Compound Name | 5-methoxy-1,1-diphenylpentan-2-one |
|---|---|
| PubChem CID | 115601489 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-methoxy-1,1-diphenylpentan-2-one |
| SMILES | COCCCC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-20-14-8-13-17(19)18(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,18H,8,13-14H2,1H3 |
| InChIKey | FONRBCCZFVCLQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|