C32H46O5 — CID 161483364
(5R)-6-methyl-1-[2-[2-[(5S)-6-methyl-4-oxo-5-phenylheptoxy]ethoxy]ethoxy]-5-phenylheptan-4-one (PubChem CID 161483364) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is (5R)-6-methyl-1-[2-[2-[(5S)-6-methyl-4-oxo-5-phenylheptoxy]ethoxy]ethoxy]-5-phenylheptan-4-one.
| Compound Name | (5R)-6-methyl-1-[2-[2-[(5S)-6-methyl-4-oxo-5-phenylheptoxy]ethoxy]ethoxy]-5-phenylheptan-4-one |
|---|---|
| PubChem CID | 161483364 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | (5R)-6-methyl-1-[2-[2-[(5S)-6-methyl-4-oxo-5-phenylheptoxy]ethoxy]ethoxy]-5-phenylheptan-4-one |
| SMILES | CC(C)[C@H](C(=O)CCCOCCOCCOCCCC(=O)[C@@H](c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H46O5/c1-25(2)31(27-13-7-5-8-14-27)29(33)17-11-19-35-21-23-37-24-22-36-20-12-18-30(34)32(26(3)4)28-15-9-6-10-16-28/h5-10,13-16,25-26,31-32H,11-12,17-24H2,1-4H3/t31-,32+ |
| InChIKey | WEQRGPSRTBGTQY-MEKGRNQZSA-N |
| XLogP | 6.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|