C27H38N2O3 — CID 122660037
3,3-dimethyl-N-[2-[2-[(3-methyl-2-phenylbutanoyl)amino]ethoxy]ethyl]-2-phenylbutanamide (PubChem CID 122660037) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-[2-[(3-methyl-2-phenylbutanoyl)amino]ethoxy]ethyl]-2-phenylbutanamide.
| Compound Name | 3,3-dimethyl-N-[2-[2-[(3-methyl-2-phenylbutanoyl)amino]ethoxy]ethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 122660037 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 3,3-dimethyl-N-[2-[2-[(3-methyl-2-phenylbutanoyl)amino]ethoxy]ethyl]-2-phenylbutanamide |
| SMILES | CC(C)C(C(=O)NCCOCCNC(=O)C(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O3/c1-20(2)23(21-12-8-6-9-13-21)25(30)28-16-18-32-19-17-29-26(31)24(27(3,4)5)22-14-10-7-11-15-22/h6-15,20,23-24H,16-19H2,1-5H3,(H,28,30)(H,29,31) |
| InChIKey | JDGNTQSCFUDCBT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|