C18H21NO3S — CID 24751947
N-(4-oxo-5,5-diphenylpentyl)methanesulfonamide (PubChem CID 24751947) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(4-oxo-5,5-diphenylpentyl)methanesulfonamide.
| Compound Name | N-(4-oxo-5,5-diphenylpentyl)methanesulfonamide |
|---|---|
| PubChem CID | 24751947 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(4-oxo-5,5-diphenylpentyl)methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3S/c1-23(21,22)19-14-8-13-17(20)18(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,18-19H,8,13-14H2,1H3 |
| InChIKey | JDYLWTVHXMNKER-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|