About 1-ethylsulfanylethyl benzoate
1-ethylsulfanylethyl benzoate (PubChem CID 132576408) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-ethylsulfanylethyl benzoate.
Molecular Properties
| Compound Name | 1-ethylsulfanylethyl benzoate |
| PubChem CID | 132576408 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-ethylsulfanylethyl benzoate |
| SMILES | CCSC(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-3-14-9(2)13-11(12)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| InChIKey | PJPOGYQHBCRDAF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylsulfanylethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfanylethyl benzoate?
The IUPAC name of 1-ethylsulfanylethyl benzoate (CID 132576408) is 1-ethylsulfanylethyl benzoate.
What is the SMILES notation for 1-ethylsulfanylethyl benzoate?
The canonical SMILES for 1-ethylsulfanylethyl benzoate is CCSC(C)OC(=O)c1ccccc1.
What is the InChIKey of 1-ethylsulfanylethyl benzoate?
The InChIKey is PJPOGYQHBCRDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-3-14-9(2)13-11(12)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3.
What are the key properties of 1-ethylsulfanylethyl benzoate?
1-ethylsulfanylethyl benzoate has a molecular weight of 210.30 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfanylethyl benzoate is sourced from PubChem (CID 132576408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).